1.0 2016-05-19 04:11:22 UTC 2026-08-19 08:41:11 UTC Triflumuron SmallMolecule Triflumuron is an organic compound with the chemical formula C15H10ClF3N2O3 and an average molecular weight of 358.70 g/mol. Triflumuron belongs to the n-phenylureas, a subclass of benzene and substituted derivatives within the organic compounds. Within the chemical hierarchy, it is further classified as part of the benzenoids superclass. This substance has been identified in or released from four recorded sources. These sources include building and construction materials such as floors, tents, or canopies, as well as food, food processing and cookware specifically related to the preparation of malt. Additionally, it has been found in household cleaning and consumer products, specifically cigar cigarettes. 1-(2-chlorobenzoyl)-3-[4-(trifluoromethoxy)phenyl]urea 2-chloro-N-[[[4-(trifluoromethoxy)phenyl]amino]carbonyl]benzamide C15H10ClF3N2O3 358.7 358.0332044 3-[(2-chlorophenyl)(hydroxy)methylidene]-1-[4-(trifluoromethoxy)phenyl]urea 3-[(2-chlorophenyl)(hydroxy)methylidene]-1-[4-(trifluoromethoxy)phenyl]urea 64628-44-0 OC(=NC(=O)NC1=CC=C(OC(F)(F)F)C=C1)C1=CC=CC=C1Cl InChI=1S/C15H10ClF3N2O3/c16-12-4-2-1-3-11(12)13(22)21-14(23)20-9-5-7-10(8-6-9)24-15(17,18)19/h1-8H,(H2,20,21,22,23) XAIPTRIXGHTTNT-UHFFFAOYSA-N Organic compounds Benzenoids Benzene and substituted derivatives N-phenylureas N-benzoyl-N'-phenylureas 2-halobenzoic acids and derivatives Alkyl fluorides Aryl chlorides Benzoyl derivatives Carbonyl compounds Carboxylic acids and derivatives Chlorobenzenes Hydrocarbon derivatives Organic oxides Organochlorides Organofluorides Organonitrogen compounds Organopnictogen compounds Phenol ethers Phenoxy compounds Trihalomethanes Ureas Vinylogous halides 2-halobenzoic acid or derivatives Alkyl fluoride Alkyl halide Aromatic homomonocyclic compound Aryl chloride Aryl halide Benzoic acid or derivatives Benzoyl Carbonic acid derivative Carbonyl group Carboxylic acid derivative Chlorobenzene Halobenzene Halobenzoic acid or derivatives Halomethane Hydrocarbon derivative N-benzoyl-n'-phenylurea Organic nitrogen compound Organic oxide Organic oxygen compound Organochloride Organofluoride Organohalogen compound Organonitrogen compound Organooxygen compound Organopnictogen compound Phenol ether Phenoxy compound Trihalomethane Urea Vinylogous halide Aromatic homomonocyclic compounds Pesticides aromatic ether benzoylurea insecticide monochlorobenzenes organofluorine compound Detected and Not Quantified logp 5.6 logp 3.80 ALOGPS logs -5.29 ALOGPS solubility 1.83e-03 g/l ALOGPS logp 5.12 ChemAxon pka_strongest_acidic 6.42 ChemAxon pka_strongest_basic -4.8 ChemAxon iupac 3-[(2-chlorophenyl)(hydroxy)methylidene]-1-[4-(trifluoromethoxy)phenyl]urea ChemAxon average_mass 358.7 ChemAxon mono_mass 358.0332044 ChemAxon smiles OC(=NC(=O)NC1=CC=C(OC(F)(F)F)C=C1)C1=CC=CC=C1Cl ChemAxon formula C15H10ClF3N2O3 ChemAxon inchi InChI=1S/C15H10ClF3N2O3/c16-12-4-2-1-3-11(12)13(22)21-14(23)20-9-5-7-10(8-6-9)24-15(17,18)19/h1-8H,(H2,20,21,22,23) ChemAxon inchikey XAIPTRIXGHTTNT-UHFFFAOYSA-N ChemAxon polar_surface_area 70.92 ChemAxon refractivity 78.03 ChemAxon polarizability 31.1 ChemAxon rotatable_bond_count 4 ChemAxon acceptor_count 4 ChemAxon donor_count 2 ChemAxon physiological_charge -1 ChemAxon formal_charge 0 ChemAxon #<HealthEffect::ActiveRecord_Associations_CollectionProxy:0x00007f7226252f98> 47445 43172