1.0 2016-05-22 03:27:41 UTC 2026-04-05 19:53:49 UTC 4-Hydrazinobenzoic acid hydrochloride SmallMolecule 4-Hydrazinobenzoic acid hydrochloride belongs to the benzoic acids and derivatives, a subclass of benzene and substituted derivatives within the organic compounds. This benzenoid compound has the formula C7H9ClN2O2 and an average molecular weight of 188.61 g/mol. C7H9ClN2O2 188.61 188.0352552 4-hydrazinylbenzoic acid hydrochloride 4-hydrazinylbenzoic acid hydrochloride 24589-77-3 Cl.NNC1=CC=C(C=C1)C(O)=O InChI=1S/C7H8N2O2.ClH/c8-9-6-3-1-5(2-4-6)7(10)11;/h1-4,9H,8H2,(H,10,11);1H XHLQMKQBCHYRLC-UHFFFAOYSA-N Organic compounds Benzenoids Benzene and substituted derivatives Benzoic acids and derivatives Benzoic acids Benzoyl derivatives Carboxylic acids Hydrazines and derivatives Hydrocarbon derivatives Hydrochlorides Monocarboxylic acids and derivatives Organic oxides Organooxygen compounds Organopnictogen compounds Phenylhydrazines Aromatic homomonocyclic compound Benzoic acid Benzoyl Carboxylic acid Carboxylic acid derivative Hydrazine derivative Hydrocarbon derivative Hydrochloride Monocarboxylic acid or derivatives Organic nitrogen compound Organic oxide Organic oxygen compound Organonitrogen compound Organooxygen compound Organopnictogen compound Phenylhydrazine Aromatic homomonocyclic compounds Detected and Not Quantified logp 0.39 ALOGPS logs -1.25 ALOGPS solubility 8.56e+00 g/l ALOGPS logp 0.18 ChemAxon pka_strongest_acidic 4.34 ChemAxon pka_strongest_basic 5.27 ChemAxon iupac 4-hydrazinylbenzoic acid hydrochloride ChemAxon average_mass 188.61 ChemAxon mono_mass 188.0352552 ChemAxon smiles Cl.NNC1=CC=C(C=C1)C(O)=O ChemAxon formula C7H9ClN2O2 ChemAxon inchi InChI=1S/C7H8N2O2.ClH/c8-9-6-3-1-5(2-4-6)7(10)11;/h1-4,9H,8H2,(H,10,11);1H ChemAxon inchikey XHLQMKQBCHYRLC-UHFFFAOYSA-N ChemAxon polar_surface_area 75.35 ChemAxon refractivity 43.02 ChemAxon polarizability 14.96 ChemAxon rotatable_bond_count 2 ChemAxon acceptor_count 4 ChemAxon donor_count 3 ChemAxon physiological_charge -1 ChemAxon formal_charge 0 ChemAxon #<HealthEffect::ActiveRecord_Associations_CollectionProxy:0x00007f72258a9cf8> 161712272