1.0 2016-05-22 03:41:56 UTC 2026-08-20 04:35:47 UTC Iodipamide SmallMolecule Iodipamide (C20H14I6N2O6) is a chemical compound used in x-ray contrast media and iodinated pharmaceuticals. Iodipamide belongs to the benzoic acids and derivatives, a subclass of benzene and substituted derivatives within the organic compounds. With an average molecular weight of 1,140 g/mol, Iodipamide is a heavy molecule. This compound is found in or released from three recorded sources: healthcare, pharmaceuticals and veterinary products, electrically stimulated smoking devices, and non-electric simulated smoking devices. Recorded exposure routes include intrauterine and intravenous administration. In terms of biological activity, Iodipamide has one recorded protein target as a binder of albumin (ALB). Iodipamid C20H14I6N2O6 1139.7618 1139.51199671 3-{5-[(3-carboxy-2,4,6-triiodophenyl)carbamoyl]pentanamido}-2,4,6-triiodobenzoic acid iodipamide 606-17-7 OC(=O)C1=C(I)C(NC(=O)CCCCC(=O)NC2=C(I)C=C(I)C(C(O)=O)=C2I)=C(I)C=C1I InChI=1S/C20H14I6N2O6/c21-7-5-9(23)17(15(25)13(7)19(31)32)27-11(29)3-1-2-4-12(30)28-18-10(24)6-8(22)14(16(18)26)20(33)34/h5-6H,1-4H2,(H,27,29)(H,28,30)(H,31,32)(H,33,34) FFINMCNLQNTKLU-UHFFFAOYSA-N Organic compounds Benzenoids Benzene and substituted derivatives Benzoic acids and derivatives Acylaminobenzoic acid and derivatives 1-carboxy-2-haloaromatic compounds 2-halobenzoic acids 4-halobenzoic acids Anilides Aryl iodides Benzoic acids Benzoyl derivatives Carbonyl compounds Dicarboxylic acids and derivatives Fatty amides Halobenzoic acids Hydrocarbon derivatives Iodobenzenes N-arylamides Organic oxides Organoiodides Organopnictogen compounds Secondary carboxylic acid amides Vinylogous halides 1-carboxy-2-haloaromatic compound 2-halobenzoic acid 2-halobenzoic acid or derivatives 4-halobenzoic acid 4-halobenzoic acid or derivatives Acylaminobenzoic acid or derivatives Anilide Aromatic homomonocyclic compound Aryl halide Aryl iodide Benzoic acid Benzoyl Carbonyl group Carboxamide group Carboxylic acid Carboxylic acid derivative Dicarboxylic acid or derivatives Fatty acyl Fatty amide Halobenzene Halobenzoic acid Halobenzoic acid or derivatives Hydrocarbon derivative Iodobenzene N-arylamide Organic nitrogen compound Organic oxide Organic oxygen compound Organohalogen compound Organoiodide Organonitrogen compound Organooxygen compound Organopnictogen compound Secondary carboxylic acid amide Vinylogous halide Aromatic homomonocyclic compounds Detected and Not Quantified Iodipamide Metabolism SMP0126892 Iodipamide Drug Metabolism Action Pathway SMP0143901 logp 8.25 logp 3.42 ALOGPS logs -5.57 ALOGPS solubility 3.06e-03 g/l ALOGPS logp 8.25 ChemAxon pka_strongest_acidic 2.03 ChemAxon pka_strongest_basic -3.4 ChemAxon iupac 3-{5-[(3-carboxy-2,4,6-triiodophenyl)carbamoyl]pentanamido}-2,4,6-triiodobenzoic acid ChemAxon average_mass 1139.7618 ChemAxon mono_mass 1139.51199671 ChemAxon smiles OC(=O)C1=C(I)C(NC(=O)CCCCC(=O)NC2=C(I)C=C(I)C(C(O)=O)=C2I)=C(I)C=C1I ChemAxon formula C20H14I6N2O6 ChemAxon inchi InChI=1S/C20H14I6N2O6/c21-7-5-9(23)17(15(25)13(7)19(31)32)27-11(29)3-1-2-4-12(30)28-18-10(24)6-8(22)14(16(18)26)20(33)34/h5-6H,1-4H2,(H,27,29)(H,28,30)(H,31,32)(H,33,34) ChemAxon inchikey FFINMCNLQNTKLU-UHFFFAOYSA-N ChemAxon polar_surface_area 132.8 ChemAxon refractivity 183.98 ChemAxon polarizability 69.71 ChemAxon rotatable_bond_count 9 ChemAxon acceptor_count 6 ChemAxon donor_count 4 ChemAxon physiological_charge -2 ChemAxon formal_charge 0 ChemAxon #<HealthEffect::ActiveRecord_Associations_CollectionProxy:0x00007f7224c45340> DB04711 3739 3608 BE0000530