1.0 2016-05-22 03:45:47 UTC 2026-05-14 16:24:30 UTC Ramipril SmallMolecule Ramipril is an organic compound with the formula C23H32N2O5 and an average molecular weight of 416.51 g/mol. Ramipril belongs to the amino acids, peptides, and analogues, a subclass of carboxylic acids and derivatives within the organic compounds. This compound is found in or released from two recorded sources: healthcare, pharmaceuticals & veterinary products, specifically as lipid modifying agents and ACE inhibitors. The recorded route of exposure is oral. Regarding its biological activity, ramipril interacts with two recorded protein targets, acting as an activator or inhibitor of the B1 bradykinin receptor (BDKRB1) and the angiotensin-converting enzyme (ACE). C23H32N2O5 416.5106 416.231122144 (2S,3aS,6aS)-1-[(2S)-2-{[(2S)-1-ethoxy-1-oxo-4-phenylbutan-2-yl]amino}propanoyl]-octahydrocyclopenta[b]pyrrole-2-carboxylic acid ramipril 87333-19-5 [H][C@@]12CCC[C@]1([H])N([C@@H](C2)C(O)=O)C(=O)[C@H](C)N[C@@H](CCC1=CC=CC=C1)C(=O)OCC InChI=1S/C23H32N2O5/c1-3-30-23(29)18(13-12-16-8-5-4-6-9-16)24-15(2)21(26)25-19-11-7-10-17(19)14-20(25)22(27)28/h4-6,8-9,15,17-20,24H,3,7,10-14H2,1-2H3,(H,27,28)/t15-,17-,18-,19-,20-/m0/s1 HDACQVRGBOVJII-JBDAPHQKSA-N Organic compounds Organic acids and derivatives Carboxylic acids and derivatives Amino acids, peptides, and analogues Dipeptides Alpha amino acid amides Alpha amino acid esters Amino acids Aralkylamines Azacyclic compounds Benzene and substituted derivatives Carbonyl compounds Carboxylic acid esters Carboxylic acids Dialkylamines Dicarboxylic acids and derivatives Fatty acid esters Hydrocarbon derivatives N-acyl-L-alpha-amino acids N-acylpyrrolidines Organic oxides Organopnictogen compounds Pyrrolidine carboxylic acids Tertiary carboxylic acid amides Alpha-amino acid amide Alpha-amino acid ester Alpha-amino acid or derivatives Alpha-dipeptide Amine Amino acid Amino acid or derivatives Aralkylamine Aromatic heteropolycyclic compound Azacycle Benzenoid Carbonyl group Carboxamide group Carboxylic acid Carboxylic acid ester Dicarboxylic acid or derivatives Fatty acid ester Fatty acyl Hydrocarbon derivative Monocyclic benzene moiety N-acyl-alpha amino acid or derivatives N-acyl-alpha-amino acid N-acyl-l-alpha-amino acid N-acylpyrrolidine Organic nitrogen compound Organic oxide Organic oxygen compound Organoheterocyclic compound Organonitrogen compound Organooxygen compound Organopnictogen compound Pyrrolidine Pyrrolidine carboxylic acid Pyrrolidine carboxylic acid or derivatives Secondary aliphatic amine Secondary amine Tertiary carboxylic acid amide Aromatic heteropolycyclic compounds azabicycloalkane cyclopentapyrrole dicarboxylic acid monoester dipeptide ethyl ester Detected and Not Quantified Ramipril Action Pathway SMP0000154 Ramipril Metabolism Pathway SMP0000597 Ramipril ACE Inhibitor Action Pathway SMP0123095 Ramipril Drug Metabolism Action Pathway SMP0142641 logp 1.47 logp 0.92 ALOGPS logs -4.03 ALOGPS solubility 3.90e-02 g/l ALOGPS logp 1.47 ChemAxon pka_strongest_acidic 3.75 ChemAxon pka_strongest_basic 5.2 ChemAxon iupac (2S,3aS,6aS)-1-[(2S)-2-{[(2S)-1-ethoxy-1-oxo-4-phenylbutan-2-yl]amino}propanoyl]-octahydrocyclopenta[b]pyrrole-2-carboxylic acid ChemAxon average_mass 416.5106 ChemAxon mono_mass 416.231122144 ChemAxon smiles [H][C@@]12CCC[C@]1([H])N([C@@H](C2)C(O)=O)C(=O)[C@H](C)N[C@@H](CCC1=CC=CC=C1)C(=O)OCC ChemAxon formula C23H32N2O5 ChemAxon inchi InChI=1S/C23H32N2O5/c1-3-30-23(29)18(13-12-16-8-5-4-6-9-16)24-15(2)21(26)25-19-11-7-10-17(19)14-20(25)22(27)28/h4-6,8-9,15,17-20,24H,3,7,10-14H2,1-2H3,(H,27,28)/t15-,17-,18-,19-,20-/m0/s1 ChemAxon inchikey HDACQVRGBOVJII-JBDAPHQKSA-N ChemAxon polar_surface_area 95.94 ChemAxon refractivity 111.19 ChemAxon polarizability 44.78 ChemAxon rotatable_bond_count 10 ChemAxon acceptor_count 5 ChemAxon donor_count 2 ChemAxon physiological_charge -1 ChemAxon formal_charge 0 ChemAxon #<HealthEffect::ActiveRecord_Associations_CollectionProxy:0x00007f7244eed208> DB00178 6992028 4514937 BE0000221 BE0005831