1.0 2016-05-22 03:46:08 UTC 2026-08-20 03:19:31 UTC Sparfloxacin SmallMolecule Sparfloxacin is an organic compound with the formula C19H22F2N4O3 and an average molecular weight of 392.40 g/mol. Sparfloxacin belongs to the quinoline carboxylic acids, a subclass of quinolines and derivatives within the organic compounds. It is further categorized under the superclass of organoheterocyclic compounds. The compound is found in or released from nine recorded sources. These include healthcare, pharmaceuticals and veterinary products, specifically antibiotics; food, food processing and cookware, specifically processing meats; and household cleaning and consumer products, specifically bleaching agents. Additionally, it is associated with electrical and electronic equipment, including antennas, electric switches, radio transmission systems, television systems, electrically stimulated smoking devices, and one other source. Recorded exposure routes for this substance include inhalation and oral administration. At the molecular level, sparfloxacin interacts with four recorded protein targets. It functions as an inhibitor or modulator of DNA gyrase subunit A (gyrA), DNA topoisomerase 4 subunit A (parC), DNA gyrase subunit B (gyrB), and DNA topoisomerase 2-alpha (TOP2A). C19H22F2N4O3 392.3998 392.165997 5-amino-1-cyclopropyl-7-[(3R,5S)-3,5-dimethylpiperazin-1-yl]-6,8-difluoro-4-oxo-1,4-dihydroquinoline-3-carboxylic acid sparfloxacin 110871-86-8 C[C@H]1CN(C[C@@H](C)N1)C1=C(F)C(N)=C2C(=O)C(=CN(C3CC3)C2=C1F)C(O)=O InChI=1S/C19H22F2N4O3/c1-8-5-24(6-9(2)23-8)17-13(20)15(22)12-16(14(17)21)25(10-3-4-10)7-11(18(12)26)19(27)28/h7-10,23H,3-6,22H2,1-2H3,(H,27,28)/t8-,9+ DZZWHBIBMUVIIW-DTORHVGOSA-N Organic compounds Organoheterocyclic compounds Quinolines and derivatives Quinoline carboxylic acids Quinoline carboxylic acids Amino acids Aminoquinolines and derivatives Aryl fluorides Azacyclic compounds Benzenoids Carboxylic acids Dialkylamines Dialkylarylamines Fluoroquinolones Haloquinolines Heteroaromatic compounds Hydrocarbon derivatives Hydroquinolines Hydroquinolones Monocarboxylic acids and derivatives N-arylpiperazines Organic oxides Organofluorides Organooxygen compounds Organopnictogen compounds Primary amines Pyridinecarboxylic acids Vinylogous amides 1,4-diazinane Amine Amino acid Amino acid or derivatives Aminoquinoline Aromatic heteropolycyclic compound Aryl fluoride Aryl halide Azacycle Benzenoid Carboxylic acid Carboxylic acid derivative Dialkylarylamine Dihydroquinoline Dihydroquinolone Fluoroquinolone Haloquinoline Heteroaromatic compound Hydrocarbon derivative Monocarboxylic acid or derivatives N-arylpiperazine Organic nitrogen compound Organic oxide Organic oxygen compound Organofluoride Organohalogen compound Organonitrogen compound Organooxygen compound Organopnictogen compound Piperazine Primary amine Pyridine Pyridine carboxylic acid Pyridine carboxylic acid or derivatives Quinoline-3-carboxylic acid Secondary aliphatic amine Secondary amine Tertiary aliphatic/aromatic amine Tertiary amine Vinylogous amide Aromatic heteropolycyclic compounds N-arylpiperazine fluoroquinolone antibiotic quinolinemonocarboxylic acid quinolone quinolone antibiotic Detected and Not Quantified Sparfloxacin Drug Metabolism Action Pathway SMP0143626 logp -0.081 logp -0.07 ALOGPS logs -3.54 ALOGPS solubility 1.13e-01 g/l ALOGPS logp -0.043 ChemAxon pka_strongest_acidic 5.75 ChemAxon pka_strongest_basic 8.79 ChemAxon iupac 5-amino-1-cyclopropyl-7-[(3R,5S)-3,5-dimethylpiperazin-1-yl]-6,8-difluoro-4-oxo-1,4-dihydroquinoline-3-carboxylic acid ChemAxon average_mass 392.3998 ChemAxon mono_mass 392.165997 ChemAxon smiles C[C@H]1CN(C[C@@H](C)N1)C1=C(F)C(N)=C2C(=O)C(=CN(C3CC3)C2=C1F)C(O)=O ChemAxon formula C19H22F2N4O3 ChemAxon inchi InChI=1S/C19H22F2N4O3/c1-8-5-24(6-9(2)23-8)17-13(20)15(22)12-16(14(17)21)25(10-3-4-10)7-11(18(12)26)19(27)28/h7-10,23H,3-6,22H2,1-2H3,(H,27,28)/t8-,9+ ChemAxon inchikey DZZWHBIBMUVIIW-DTORHVGOSA-N ChemAxon polar_surface_area 98.9 ChemAxon refractivity 101.69 ChemAxon polarizability 38.98 ChemAxon rotatable_bond_count 3 ChemAxon acceptor_count 7 ChemAxon donor_count 3 ChemAxon physiological_charge 0 ChemAxon formal_charge 0 ChemAxon #<HealthEffect::ActiveRecord_Associations_CollectionProxy:0x00007f7225e917d8> DB01208 60464 54517 BE0000366 BE0000429 BE0000742 BE0008385 BE0002388