1.0 2016-05-22 04:30:42 UTC 2026-05-14 17:22:54 UTC Urocanic acid SmallMolecule Urocanic acid is an organic compound with the chemical formula C6H6N2O2 and an average molecular weight of 138.12 g/mol. Urocanic acid belongs to the imidazoles, a subclass of azoles within the organic compounds. In an industrial context, the compound is utilized as a UV stabilizer. The substance is found in or released from five recorded sources. Within the category of food, food processing, and cookware, it is associated with the processing of meats, the processing of fish, and the preparation of vinegar. Additionally, it is found in electrical and electronic equipment, specifically in antennas and auxiliary devices. Regarding its biological activity, urocanic acid has one recorded protein target, which is urocanate hydratase (hutU). Imidazoleacrylic acid C6H6N2O2 138.124 138.042927446 (2E)-3-(1H-imidazol-4-yl)prop-2-enoic acid trans-urocanic acid 104-98-3 OC(=O)\C=C\C1=CNC=N1 InChI=1S/C6H6N2O2/c9-6(10)2-1-5-3-7-4-8-5/h1-4H,(H,7,8)(H,9,10)/b2-1+ LOIYMIARKYCTBW-OWOJBTEDSA-N Organic compounds Organoheterocyclic compounds Azoles Imidazoles Imidazolyl carboxylic acids and derivatives Azacyclic compounds Carbonyl compounds Carboxylic acids Heteroaromatic compounds Hydrocarbon derivatives Monocarboxylic acids and derivatives Organic oxides Organonitrogen compounds Organopnictogen compounds Aromatic heteromonocyclic compound Azacycle Carbonyl group Carboxylic acid Carboxylic acid derivative Heteroaromatic compound Hydrocarbon derivative Imidazolyl carboxylic acid derivative Monocarboxylic acid or derivatives Organic nitrogen compound Organic oxide Organic oxygen compound Organonitrogen compound Organooxygen compound Organopnictogen compound Aromatic heteromonocyclic compounds urocanic acid Detected and Not Quantified Ammonia Recycling SMP0000009 Histidine Metabolism SMP0000044 Histidinemia SMP0000191 Histidinemia SMP0125711 Keratinization SMP0674009 logp -1 logp 0.22 ALOGPS logs -0.51 ALOGPS solubility 4.25e+01 g/l ALOGPS logp -1 ChemAxon pka_strongest_acidic 3.85 ChemAxon pka_strongest_basic 6.13 ChemAxon iupac (2E)-3-(1H-imidazol-4-yl)prop-2-enoic acid ChemAxon average_mass 138.124 ChemAxon mono_mass 138.042927446 ChemAxon smiles OC(=O)\C=C\C1=CNC=N1 ChemAxon formula C6H6N2O2 ChemAxon inchi InChI=1S/C6H6N2O2/c9-6(10)2-1-5-3-7-4-8-5/h1-4H,(H,7,8)(H,9,10)/b2-1+ ChemAxon inchikey LOIYMIARKYCTBW-OWOJBTEDSA-N ChemAxon polar_surface_area 65.98 ChemAxon refractivity 35.57 ChemAxon polarizability 13.1 ChemAxon rotatable_bond_count 2 ChemAxon acceptor_count 3 ChemAxon donor_count 2 ChemAxon physiological_charge -1 ChemAxon formal_charge 0 ChemAxon #<HealthEffect::ActiveRecord_Associations_CollectionProxy:0x00007f7225c6b9b8> DB01971 736715 643824 BE0001420