1.0 2016-05-22 05:21:55 UTC 2026-08-24 03:27:39 UTC Nitromide SmallMolecule Nitromide is an organic compound with the chemical formula C7H5N3O5 and an average molecular weight of 211.13 g/mol. Nitromide belongs to the nitrobenzenes, a subclass of benzene and substituted derivatives within the organic compounds. This compound is associated with four recorded sources of occurrence or release. These include electrical and electronic equipment, specifically amplifiers and electrodes, as well as food preservation within food, food processing, and cookware. Additionally, it is found in household cleaning and consumer products, specifically tobacco smoke filters. C7H5N3O5 211.133 211.022920273 3,5-dinitrobenzene-1-carboximidic acid unistat 121-81-3 OC(=N)C1=CC(=CC(=C1)N(=O)=O)N(=O)=O InChI=1S/C7H5N3O5/c8-7(11)4-1-5(9(12)13)3-6(2-4)10(14)15/h1-3H,(H2,8,11) UUKWKUSGGZNXGA-UHFFFAOYSA-N Organic compounds Benzenoids Benzene and substituted derivatives Nitrobenzenes Nitrobenzenes Benzamides Benzoyl derivatives Hydrocarbon derivatives Nitroaromatic compounds Organic oxides Organic oxoazanium compounds Organic zwitterions Organonitrogen compounds Organooxygen compounds Organopnictogen compounds Primary carboxylic acid amides Propargyl-type 1,3-dipolar organic compounds Allyl-type 1,3-dipolar organic compound Aromatic homomonocyclic compound Benzamide Benzoic acid or derivatives Benzoyl C-nitro compound Carboxamide group Carboxylic acid derivative Hydrocarbon derivative Nitroaromatic compound Nitrobenzene Organic 1,3-dipolar compound Organic nitro compound Organic nitrogen compound Organic oxide Organic oxoazanium Organic oxygen compound Organic zwitterion Organonitrogen compound Organooxygen compound Organopnictogen compound Primary carboxylic acid amide Propargyl-type 1,3-dipolar organic compound Aromatic homomonocyclic compounds Detected and Not Quantified logp 0.8 logp 0.58 ALOGPS logs -3.33 ALOGPS solubility 9.79e-02 g/l ALOGPS logp 1.14 ChemAxon pka_strongest_acidic 5.96 ChemAxon pka_strongest_basic 4.34 ChemAxon iupac 3,5-dinitrobenzene-1-carboximidic acid ChemAxon average_mass 211.133 ChemAxon mono_mass 211.022920273 ChemAxon smiles OC(=N)C1=CC(=CC(=C1)N(=O)=O)N(=O)=O ChemAxon formula C7H5N3O5 ChemAxon inchi InChI=1S/C7H5N3O5/c8-7(11)4-1-5(9(12)13)3-6(2-4)10(14)15/h1-3H,(H2,8,11) ChemAxon inchikey UUKWKUSGGZNXGA-UHFFFAOYSA-N ChemAxon polar_surface_area 135.72 ChemAxon refractivity 60.72 ChemAxon polarizability 17.36 ChemAxon rotatable_bond_count 3 ChemAxon acceptor_count 6 ChemAxon donor_count 2 ChemAxon physiological_charge 0 ChemAxon formal_charge 0 ChemAxon #<HealthEffect::ActiveRecord_Associations_CollectionProxy:0x00007f72273ad360> 4511 4355