1.0 2016-05-22 05:35:01 UTC 2026-08-20 05:25:35 UTC Lifibrate SmallMolecule Lifibrate is an organic compound with the formula C20H21Cl2NO4 and an average molecular weight of 410.29 g/mol. Lifibrate belongs to the phenoxyacetic acid derivatives, a subclass of benzene and substituted derivatives within the organic compounds. It is further classified within the superclass of benzenoids. This compound has been identified in or released from five recorded sources. These sources consist of electrical and electronic equipment, specifically amplifiers, electric hearing aids, microphones, radio transmission systems, and television systems. C20H21Cl2NO4 410.29 409.0847636 1-methylpiperidin-4-yl 2,2-bis(4-chlorophenoxy)acetate lifibrate 22204-91-7 CN1CCC(CC1)OC(=O)C(OC1=CC=C(Cl)C=C1)OC1=CC=C(Cl)C=C1 InChI=1S/C20H21Cl2NO4/c1-23-12-10-18(11-13-23)25-19(24)20(26-16-6-2-14(21)3-7-16)27-17-8-4-15(22)5-9-17/h2-9,18,20H,10-13H2,1H3 QDGIAPPCJRFVEK-UHFFFAOYSA-N Organic compounds Benzenoids Benzene and substituted derivatives Phenoxyacetic acid derivatives Phenoxyacetic acid derivatives Acetals Amino acids and derivatives Aryl chlorides Azacyclic compounds Carbonyl compounds Carboxylic acid esters Chlorobenzenes Hydrocarbon derivatives Monocarboxylic acids and derivatives Organic oxides Organochlorides Organopnictogen compounds Phenol ethers Phenoxy compounds Piperidines Trialkylamines Acetal Amine Amino acid or derivatives Aromatic heteromonocyclic compound Aryl chloride Aryl halide Azacycle Carbonyl group Carboxylic acid derivative Carboxylic acid ester Chlorobenzene Halobenzene Hydrocarbon derivative Monocarboxylic acid or derivatives Organic nitrogen compound Organic oxide Organic oxygen compound Organochloride Organohalogen compound Organoheterocyclic compound Organonitrogen compound Organooxygen compound Organopnictogen compound Phenol ether Phenoxy compound Phenoxyacetate Piperidine Tertiary aliphatic amine Tertiary amine Aromatic heteromonocyclic compounds Detected and Not Quantified logp 5.5 logp 4.32 ALOGPS logs -4.81 ALOGPS solubility 6.32e-03 g/l ALOGPS logp 4.72 ChemAxon pka_strongest_basic 8.72 ChemAxon iupac 1-methylpiperidin-4-yl 2,2-bis(4-chlorophenoxy)acetate ChemAxon average_mass 410.29 ChemAxon mono_mass 409.0847636 ChemAxon smiles CN1CCC(CC1)OC(=O)C(OC1=CC=C(Cl)C=C1)OC1=CC=C(Cl)C=C1 ChemAxon formula C20H21Cl2NO4 ChemAxon inchi InChI=1S/C20H21Cl2NO4/c1-23-12-10-18(11-13-23)25-19(24)20(26-16-6-2-14(21)3-7-16)27-17-8-4-15(22)5-9-17/h2-9,18,20H,10-13H2,1H3 ChemAxon inchikey QDGIAPPCJRFVEK-UHFFFAOYSA-N ChemAxon polar_surface_area 48 ChemAxon refractivity 103.89 ChemAxon polarizability 41.41 ChemAxon rotatable_bond_count 7 ChemAxon acceptor_count 4 ChemAxon donor_count 0 ChemAxon physiological_charge 1 ChemAxon formal_charge 0 ChemAxon #<HealthEffect::ActiveRecord_Associations_CollectionProxy:0x00007f3bb3ab7f98> DB21399 31060 28817