1.0 2016-05-22 05:45:59 UTC 2026-08-20 03:04:40 UTC Nadifloxacin SmallMolecule Nadifloxacin is an organic compound with the chemical formula C19H21FN2O4 and an average molecular weight of 360.38 g/mol. Nadifloxacin belongs to the quinoline carboxylic acids, a subclass of quinolines and derivatives within the organic compounds. It is further categorized as an organoheterocyclic compound. The substance is found in or released from six recorded sources. These include healthcare, pharmaceuticals and veterinary products, specifically antibiotics, as well as food, food processing and cookware for the purpose of food preservation. Additionally, it is associated with household cleaning and consumer products, specifically tobacco smoke filters, and electrical and electronic equipment, including electrodes, hybrid capacitors, and electrically stimulated smoking devices. Recorded exposure routes for this compound include oral and inhalation. C19H21FN2O4 360.385 360.148535327 7-fluoro-8-(4-hydroxypiperidin-1-yl)-12-methyl-4-oxo-1-azatricyclo[7.3.1.0⁵,¹³]trideca-2,5,7,9(13)-tetraene-3-carboxylic acid nadifloxacin 124858-35-1 CC1CCC2=C3N1C=C(C(O)=O)C(=O)C3=CC(F)=C2N1CCC(O)CC1 InChI=1S/C19H21FN2O4/c1-10-2-3-12-16-13(18(24)14(19(25)26)9-22(10)16)8-15(20)17(12)21-6-4-11(23)5-7-21/h8-11,23H,2-7H2,1H3,(H,25,26) JYJTVFIEFKZWCJ-UHFFFAOYSA-N Organic compounds Organoheterocyclic compounds Quinolines and derivatives Quinoline carboxylic acids Quinoline carboxylic acids Amino acids Aminoquinolines and derivatives Aryl fluorides Azacyclic compounds Benzenoids Carboxylic acids Dialkylarylamines Fluoroquinolones Haloquinolines Heteroaromatic compounds Hydrocarbon derivatives Hydroquinolines Hydroquinolones Monocarboxylic acids and derivatives Organic oxides Organofluorides Organopnictogen compounds Piperidines Pyridinecarboxylic acids Secondary alcohols Vinylogous amides Alcohol Amine Amino acid Amino acid or derivatives Aminoquinoline Aromatic heteropolycyclic compound Aryl fluoride Aryl halide Azacycle Benzenoid Carboxylic acid Carboxylic acid derivative Dialkylarylamine Dihydroquinoline Dihydroquinolone Fluoroquinolone Haloquinoline Heteroaromatic compound Hydrocarbon derivative Monocarboxylic acid or derivatives Organic nitrogen compound Organic oxide Organic oxygen compound Organofluoride Organohalogen compound Organonitrogen compound Organooxygen compound Organopnictogen compound Piperidine Pyridine Pyridine carboxylic acid Pyridine carboxylic acid or derivatives Quinoline-3-carboxylic acid Secondary alcohol Tertiary aliphatic/aromatic amine Tertiary amine Vinylogous amide Aromatic heteropolycyclic compounds heteroarylpiperidine hydroxypiperidine pyridoquinoline quinolone antibiotic Detected and Not Quantified logp 1.84 logp 0.87 ALOGPS logs -2.76 ALOGPS solubility 6.32e-01 g/l ALOGPS logp 1.84 ChemAxon pka_strongest_acidic 6.13 ChemAxon pka_strongest_basic 0.44 ChemAxon iupac 7-fluoro-8-(4-hydroxypiperidin-1-yl)-12-methyl-4-oxo-1-azatricyclo[7.3.1.0⁵,¹³]trideca-2,5,7,9(13)-tetraene-3-carboxylic acid ChemAxon average_mass 360.385 ChemAxon mono_mass 360.148535327 ChemAxon smiles CC1CCC2=C3N1C=C(C(O)=O)C(=O)C3=CC(F)=C2N1CCC(O)CC1 ChemAxon formula C19H21FN2O4 ChemAxon inchi InChI=1S/C19H21FN2O4/c1-10-2-3-12-16-13(18(24)14(19(25)26)9-22(10)16)8-15(20)17(12)21-6-4-11(23)5-7-21/h8-11,23H,2-7H2,1H3,(H,25,26) ChemAxon inchikey JYJTVFIEFKZWCJ-UHFFFAOYSA-N ChemAxon polar_surface_area 81.08 ChemAxon refractivity 96.03 ChemAxon polarizability 36.53 ChemAxon rotatable_bond_count 2 ChemAxon acceptor_count 6 ChemAxon donor_count 2 ChemAxon physiological_charge -1 ChemAxon formal_charge 0 ChemAxon #<HealthEffect::ActiveRecord_Associations_CollectionProxy:0x00007f722427eb18> DB12447 4410 4257