1.0 2016-05-22 06:55:21 UTC 2026-08-18 04:25:33 UTC 5,7-Dichloro-8-hydroxy-2-methylquinoline SmallMolecule 5,7-Dichloro-8-hydroxy-2-methylquinoline belongs to the haloquinolines, a subclass of quinolines and derivatives within the organic compounds. This organoheterocyclic compound has the chemical formula C10H7Cl2NO and an average molecular weight of 228.07 g/mol. The compound is associated with 17 recorded sources across various sectors. Within healthcare, pharmaceuticals, and veterinary products, it is found in antiprotozoals, gynecologicals, throat preparations, and antiseptics and disinfectants. In the category of food, food processing, and cookware, it is utilized for food preservation. Household cleaning and consumer products containing the compound include soap detergents, perfumes within detergents and soaps, and non electric simulated smoking devices. Additionally, it is released from electrical and electronic equipment, specifically electrodes, discharge lamps, antennas, electrically stimulated smoking devices, conductors or conductive bodies characterised by the conductive materials, and four other sources. Cutaneous exposure is the recorded route for this substance. C10H7Cl2NO 228.07 226.9904692 5,7-dichloro-2-methylquinolin-8-ol chlorquinaldol 72-80-0 CC1=NC2=C(C=C1)C(Cl)=CC(Cl)=C2O InChI=1S/C10H7Cl2NO/c1-5-2-3-6-7(11)4-8(12)10(14)9(6)13-5/h2-4,14H,1H3 GPTXWRGISTZRIO-UHFFFAOYSA-N Organic compounds Organoheterocyclic compounds Quinolines and derivatives Haloquinolines Chloroquinolines 8-hydroxyquinolines Aryl chlorides Azacyclic compounds Benzenoids Heteroaromatic compounds Hydrocarbon derivatives Methylpyridines Organochlorides Organonitrogen compounds Organooxygen compounds Organopnictogen compounds 8-hydroxyquinoline Aromatic heteropolycyclic compound Aryl chloride Aryl halide Azacycle Benzenoid Chloroquinoline Heteroaromatic compound Hydrocarbon derivative Methylpyridine Organic nitrogen compound Organic oxygen compound Organochloride Organohalogen compound Organonitrogen compound Organooxygen compound Organopnictogen compound Pyridine Aromatic heteropolycyclic compounds monohydroxyquinoline organochlorine compound Detected and Not Quantified Chlorquinaldol Drug Metabolism Action Pathway SMP0144976 logp 3.17 logp 3.82 ALOGPS logs -3.63 ALOGPS solubility 5.38e-02 g/l ALOGPS logp 3.17 ChemAxon pka_strongest_acidic 6.99 ChemAxon pka_strongest_basic 4 ChemAxon iupac 5,7-dichloro-2-methylquinolin-8-ol ChemAxon average_mass 228.07 ChemAxon mono_mass 226.9904692 ChemAxon smiles CC1=NC2=C(C=C1)C(Cl)=CC(Cl)=C2O ChemAxon formula C10H7Cl2NO ChemAxon inchi InChI=1S/C10H7Cl2NO/c1-5-2-3-6-7(11)4-8(12)10(14)9(6)13-5/h2-4,14H,1H3 ChemAxon inchikey GPTXWRGISTZRIO-UHFFFAOYSA-N ChemAxon polar_surface_area 33.12 ChemAxon refractivity 56.16 ChemAxon polarizability 21.62 ChemAxon rotatable_bond_count 0 ChemAxon acceptor_count 2 ChemAxon donor_count 1 ChemAxon physiological_charge -1 ChemAxon formal_charge 0 ChemAxon #<HealthEffect::ActiveRecord_Associations_CollectionProxy:0x00007f3bd006a000> DB13306 6301 6062