1.0 2016-05-25 02:55:58 UTC 2026-08-20 01:38:06 UTC Lauroyl lysine SmallMolecule Lauroyl lysine belongs to the amino acids, peptides, and analogues, a subclass of carboxylic acids and derivatives within the organic compounds. It has the chemical formula C18H36N2O3 and an average molecular weight of 328.50 g/mol. C18H36N2O3 328.497 328.272593027 (2S)-2-amino-6-[(1-hydroxydodecylidene)amino]hexanoic acid (2S)-2-amino-6-[(1-hydroxydodecylidene)amino]hexanoic acid 52315-75-0 [H][C@](N)(CCCCN=C(O)CCCCCCCCCCC)C(O)=O InChI=1S/C18H36N2O3/c1-2-3-4-5-6-7-8-9-10-14-17(21)20-15-12-11-13-16(19)18(22)23/h16H,2-15,19H2,1H3,(H,20,21)(H,22,23)/t16-/m0/s1 GYDYJUYZBRGMCC-INIZCTEOSA-N Organic compounds Organic acids and derivatives Carboxylic acids and derivatives Amino acids, peptides, and analogues L-alpha-amino acids Amino acids Amino fatty acids Carbonyl compounds Carboxylic acids Hydrocarbon derivatives Medium-chain fatty acids Monoalkylamines Monocarboxylic acids and derivatives N-acyl amines Organic oxides Organopnictogen compounds Secondary carboxylic acid amides Aliphatic acyclic compound Amine Amino acid Amino fatty acid Carbonyl group Carboxamide group Carboxylic acid Fatty acid Fatty acyl Fatty amide Hydrocarbon derivative L-alpha-amino acid Medium-chain fatty acid Monocarboxylic acid or derivatives N-acyl-amine Organic nitrogen compound Organic oxide Organic oxygen compound Organonitrogen compound Organooxygen compound Organopnictogen compound Primary aliphatic amine Primary amine Secondary carboxylic acid amide Aliphatic acyclic compounds Detected and Not Quantified logp 2.2 logp 1.30 ALOGPS logs -4.73 ALOGPS solubility 6.11e-03 g/l ALOGPS logp 1.66 ChemAxon pka_strongest_acidic 2.12 ChemAxon pka_strongest_basic 9.53 ChemAxon iupac (2S)-2-amino-6-[(1-hydroxydodecylidene)amino]hexanoic acid ChemAxon average_mass 328.497 ChemAxon mono_mass 328.272593027 ChemAxon smiles [H][C@](N)(CCCCN=C(O)CCCCCCCCCCC)C(O)=O ChemAxon formula C18H36N2O3 ChemAxon inchi InChI=1S/C18H36N2O3/c1-2-3-4-5-6-7-8-9-10-14-17(21)20-15-12-11-13-16(19)18(22)23/h16H,2-15,19H2,1H3,(H,20,21)(H,22,23)/t16-/m0/s1 ChemAxon inchikey GYDYJUYZBRGMCC-INIZCTEOSA-N ChemAxon polar_surface_area 95.91 ChemAxon refractivity 93.81 ChemAxon polarizability 40.74 ChemAxon rotatable_bond_count 16 ChemAxon acceptor_count 5 ChemAxon donor_count 3 ChemAxon physiological_charge 0 ChemAxon formal_charge 0 ChemAxon #<HealthEffect::ActiveRecord_Associations_CollectionProxy:0x00007f3bd01783e8> 104151 9488414