1.0 2016-05-25 18:26:16 UTC 2026-05-14 16:59:08 UTC Olsalazine SmallMolecule Olsalazine is an organic compound with the formula C14H10N2O6 and an average molecular weight of 302.24 g/mol. Olsalazine belongs to the azobenzenes, a class of organoheterocyclic compounds within the organic compounds. This compound is recorded as being released from healthcare, pharmaceuticals, and veterinary products, specifically as an intestinal antiinflammatory agent. The recorded route of exposure is oral. In terms of biological activity, olsalazine acts as an inhibitor for four protein targets: Thiopurine S-methyltransferase (TPMT), Prostaglandin G/H synthase 1 (PTGS1), Prostaglandin G/H synthase 2 (PTGS2), and Xanthine dehydrogenase/oxidase (XDH). C14H10N2O6 302.239 302.053886062 5-[(E)-2-(3-carboxy-4-hydroxyphenyl)diazen-1-yl]-2-hydroxybenzoic acid olsalazine 15722-48-2 OC(=O)C1=CC(=CC=C1O)\N=N\C1=CC=C(O)C(=C1)C(O)=O InChI=1S/C14H10N2O6/c17-11-3-1-7(5-9(11)13(19)20)15-16-8-2-4-12(18)10(6-8)14(21)22/h1-6,17-18H,(H,19,20)(H,21,22)/b16-15+ QQBDLJCYGRGAKP-FOCLMDBBSA-N Organic compounds Organoheterocyclic compounds Azobenzenes Azobenzenes 1-hydroxy-2-unsubstituted benzenoids Azo compounds Benzoic acids Benzoyl derivatives Carboxylic acids Dicarboxylic acids and derivatives Hydrocarbon derivatives Organic oxides Organooxygen compounds Organopnictogen compounds Propargyl-type 1,3-dipolar organic compounds Salicylic acids Vinylogous acids 1-hydroxy-2-unsubstituted benzenoid Aromatic homomonocyclic compound Azo compound Azobenzene Benzenoid Benzoic acid Benzoic acid or derivatives Benzoyl Carboxylic acid Carboxylic acid derivative Dicarboxylic acid or derivatives Hydrocarbon derivative Hydroxybenzoic acid Monocyclic benzene moiety Organic 1,3-dipolar compound Organic nitrogen compound Organic oxide Organic oxygen compound Organonitrogen compound Organooxygen compound Organopnictogen compound Phenol Propargyl-type 1,3-dipolar organic compound Salicylic acid Salicylic acid or derivatives Vinylogous acid Aromatic homomonocyclic compounds Detected and Not Quantified logp 4.39 logp 2.77 ALOGPS logs -3.59 ALOGPS solubility 7.81e-02 g/l ALOGPS logp 4.39 ChemAxon pka_strongest_acidic 2.93 ChemAxon pka_strongest_basic -0.019 ChemAxon iupac 5-[(E)-2-(3-carboxy-4-hydroxyphenyl)diazen-1-yl]-2-hydroxybenzoic acid ChemAxon average_mass 302.239 ChemAxon mono_mass 302.053886062 ChemAxon smiles OC(=O)C1=CC(=CC=C1O)\N=N\C1=CC=C(O)C(=C1)C(O)=O ChemAxon formula C14H10N2O6 ChemAxon inchi InChI=1S/C14H10N2O6/c17-11-3-1-7(5-9(11)13(19)20)15-16-8-2-4-12(18)10(6-8)14(21)22/h1-6,17-18H,(H,19,20)(H,21,22)/b16-15+ ChemAxon inchikey QQBDLJCYGRGAKP-FOCLMDBBSA-N ChemAxon polar_surface_area 139.78 ChemAxon refractivity 78.85 ChemAxon polarizability 28.61 ChemAxon rotatable_bond_count 4 ChemAxon acceptor_count 8 ChemAxon donor_count 4 ChemAxon physiological_charge -2 ChemAxon formal_charge 0 ChemAxon #<HealthEffect::ActiveRecord_Associations_CollectionProxy:0x00007f727ba05150> DB01250 56272 BE0000987 BE0000017 BE0000262 BE0002204