1.0 2016-05-26 00:05:14 UTC 2026-04-05 20:28:31 UTC Arginine hydrochloride SmallMolecule Arginine hydrochloride is an organic compound with the formula C6H15ClN4O2 and an average molecular weight of 210.66 g/mol. Arginine hydrochloride belongs to the amino acids, peptides, and analogues, a subclass of carboxylic acids and derivatives within the organic compounds. Industrially, the compound is utilized as a conditioner and softener. C6H15ClN4O2 210.662 210.088353451 1119-34-2 Cl.N[C@@H](CCCNC(N)=N)C(O)=O InChI=1S/C6H14N4O2.ClH/c7-4(5(11)12)2-1-3-10-6(8)9;/h4H,1-3,7H2,(H,11,12)(H4,8,9,10);1H/t4-;/m0./s1 KWTQSFXGGICVPE-WCCKRBBISA-N Organic compounds Organic acids and derivatives Carboxylic acids and derivatives Amino acids, peptides, and analogues L-alpha-amino acids Amino acids Carbonyl compounds Carboximidamides Carboxylic acids Fatty acids and conjugates Guanidines Hydrocarbon derivatives Hydrochlorides Monoalkylamines Monocarboxylic acids and derivatives Organic oxides Organopnictogen compounds Propargyl-type 1,3-dipolar organic compounds Aliphatic acyclic compound Amine Amino acid Carbonyl group Carboximidamide Carboxylic acid Fatty acid Guanidine Hydrocarbon derivative Hydrochloride L-alpha-amino acid Monocarboxylic acid or derivatives Organic 1,3-dipolar compound Organic nitrogen compound Organic oxide Organic oxygen compound Organonitrogen compound Organooxygen compound Organopnictogen compound Primary aliphatic amine Primary amine Propargyl-type 1,3-dipolar organic compound Aliphatic acyclic compounds Detected and Not Quantified average_mass 210.662 ChemAxon mono_mass 210.088353451 ChemAxon smiles Cl.N[C@@H](CCCNC(N)=N)C(O)=O ChemAxon formula C6H15ClN4O2 ChemAxon inchi InChI=1S/C6H14N4O2.ClH/c7-4(5(11)12)2-1-3-10-6(8)9;/h4H,1-3,7H2,(H,11,12)(H4,8,9,10);1H/t4-;/m0./s1 ChemAxon inchikey KWTQSFXGGICVPE-WCCKRBBISA-N ChemAxon #<HealthEffect::ActiveRecord_Associations_CollectionProxy:0x00007f721f5096a8> 66250