1.0 2016-06-03 10:56:59 UTC 2026-03-31 18:49:08 UTC (2-bromo-2-nitrovinyl)benzene SmallMolecule (2-bromo-2-nitrovinyl)benzene belongs to the benzene and substituted derivatives, a class of benzenoids within the organic compounds. This compound has the chemical formula C8H6BrNO2 and an average molecular weight of 228.04 g/mol. C8H6BrNO2 228.045 226.958191 [(E)-2-bromo-2-nitroethenyl]benzene [(E)-2-bromo-2-nitroethenyl]benzene 7166-19-0 [H]\C(=C(/Br)N(=O)=O)C1=CC=CC=C1 InChI=1S/C8H6BrNO2/c9-8(10(11)12)6-7-4-2-1-3-5-7/h1-6H/b8-6- SKDNDVDHYMEGNJ-VURMDHGXSA-N Organic compounds Benzenoids Benzene and substituted derivatives Benzene and substituted derivatives Bromoalkenes C-nitro compounds Hydrocarbon derivatives Ketene acetals Organic oxides Organic oxoazanium compounds Organobromides Organonitrogen compounds Organopnictogen compounds Propargyl-type 1,3-dipolar organic compounds Vinyl bromides Allyl-type 1,3-dipolar organic compound Aromatic homomonocyclic compound Bromoalkene C-nitro compound Haloalkene Hydrocarbon derivative Ketene acetal or derivatives Monocyclic benzene moiety Organic 1,3-dipolar compound Organic nitro compound Organic nitrogen compound Organic oxide Organic oxoazanium Organic oxygen compound Organobromide Organohalogen compound Organonitrogen compound Organopnictogen compound Propargyl-type 1,3-dipolar organic compound Vinyl bromide Vinyl halide Aromatic homomonocyclic compounds Detected and Not Quantified logp 2.92 ALOGPS logs -4.45 ALOGPS solubility 8.00e-03 g/l ALOGPS logp 3.09 ChemAxon iupac [(E)-2-bromo-2-nitroethenyl]benzene ChemAxon average_mass 228.045 ChemAxon mono_mass 226.958191 ChemAxon smiles [H]\C(=C(/Br)N(=O)=O)C1=CC=CC=C1 ChemAxon formula C8H6BrNO2 ChemAxon inchi InChI=1S/C8H6BrNO2/c9-8(10(11)12)6-7-4-2-1-3-5-7/h1-6H/b8-6- ChemAxon inchikey SKDNDVDHYMEGNJ-VURMDHGXSA-N ChemAxon polar_surface_area 45.82 ChemAxon refractivity 48.88 ChemAxon polarizability 17.73 ChemAxon rotatable_bond_count 2 ChemAxon acceptor_count 2 ChemAxon donor_count 0 ChemAxon physiological_charge 0 ChemAxon formal_charge 0 ChemAxon #<HealthEffect::ActiveRecord_Associations_CollectionProxy:0x00007f3bd0025838> 6433494 4938639