1.0 2016-06-03 12:02:59 UTC 2026-08-20 06:53:44 UTC [1,3-phenylenebis(1-methylethylidene)]bis[tert-butyl] peroxide SmallMolecule [1,3-phenylenebis(1-methylethylidene)]bis[tert-butyl] peroxide is an organic compound with the formula C20H34O4 and an average molecular weight of 338.49 g/mol. [1,3-phenylenebis(1-methylethylidene)]bis[tert-butyl] peroxide belongs to the phenylpropanes, a subclass of benzene and substituted derivatives within the organic compounds. The compound is found in or released from 11 recorded sources. These include drinking water and water supply, specifically drinking water, and building and construction materials such as tents or canopies. It is also associated with food, food processing and cookware, specifically fermentation processes for beer. Additionally, it is linked to electrical and electronic equipment, including antennas, communication cables or conductors, electric switches, emergency protective devices, fixed capacitors and their manufacture, and three other sources. The recorded exposure route for this substance is oral. C20H34O4 338.488 338.245709575 1,3-bis[2-(tert-butylperoxy)propan-2-yl]benzene 1,3-bis[2-(tert-butylperoxy)propan-2-yl]benzene 2212-81-9 CC(C)(C)OOC(C)(C)C1=CC(=CC=C1)C(C)(C)OOC(C)(C)C InChI=1S/C20H34O4/c1-17(2,3)21-23-19(7,8)15-12-11-13-16(14-15)20(9,10)24-22-18(4,5)6/h11-14H,1-10H3 UBRWPVTUQDJKCC-UHFFFAOYSA-N Organic compounds Benzenoids Benzene and substituted derivatives Phenylpropanes Phenylpropanes Dialkyl peroxides Hydrocarbon derivatives Organooxygen compounds Aromatic homomonocyclic compound Dialkyl peroxide Hydrocarbon derivative Organic oxygen compound Organooxygen compound Phenylpropane Aromatic homomonocyclic compounds Detected and Not Quantified logp 4.5 logp 6.48 ALOGPS logs -5.69 ALOGPS solubility 6.97e-04 g/l ALOGPS logp 5.6 ChemAxon pka_strongest_basic -4.6 ChemAxon iupac 1,3-bis[2-(tert-butylperoxy)propan-2-yl]benzene ChemAxon average_mass 338.488 ChemAxon mono_mass 338.245709575 ChemAxon smiles CC(C)(C)OOC(C)(C)C1=CC(=CC=C1)C(C)(C)OOC(C)(C)C ChemAxon formula C20H34O4 ChemAxon inchi InChI=1S/C20H34O4/c1-17(2,3)21-23-19(7,8)15-12-11-13-16(14-15)20(9,10)24-22-18(4,5)6/h11-14H,1-10H3 ChemAxon inchikey UBRWPVTUQDJKCC-UHFFFAOYSA-N ChemAxon polar_surface_area 36.92 ChemAxon refractivity 97.08 ChemAxon polarizability 38.98 ChemAxon rotatable_bond_count 8 ChemAxon acceptor_count 4 ChemAxon donor_count 0 ChemAxon physiological_charge 0 ChemAxon formal_charge 0 ChemAxon #<HealthEffect::ActiveRecord_Associations_CollectionProxy:0x00007f3bb3d323b8> 16654 15791