1.0 2016-06-03 13:24:09 UTC 2026-08-24 09:44:29 UTC (3-aminophenyl)uronium SmallMolecule (3-aminophenyl)uronium belongs to the n-phenylureas, a subclass of benzene and substituted derivatives within the organic compounds. This benzenoid compound has the formula C7H9N3O and an average molecular weight of 151.17 g/mol. C7H9N3O 151.169 151.074561922 N-(3-aminophenyl)carbamimidic acid N-(3-aminophenyl)carbamimidic acid 25711-72-2 NC1=CC(NC(O)=N)=CC=C1 InChI=1S/C7H9N3O/c8-5-2-1-3-6(4-5)10-7(9)11/h1-4H,8H2,(H3,9,10,11) ZNXSFVXZQBETRJ-UHFFFAOYSA-N Organic compounds Benzenoids Benzene and substituted derivatives N-phenylureas N-phenylureas Aniline and substituted anilines Carbonyl compounds Hydrocarbon derivatives Organic oxides Organopnictogen compounds Primary amines Ureas Amine Aniline or substituted anilines Aromatic homomonocyclic compound Carbonic acid derivative Carbonyl group Hydrocarbon derivative N-phenylurea Organic nitrogen compound Organic oxide Organic oxygen compound Organonitrogen compound Organooxygen compound Organopnictogen compound Primary amine Urea Aromatic homomonocyclic compounds Detected and Not Quantified logp 0.7 logp 0.06 ALOGPS logs -2.03 ALOGPS solubility 1.40e+00 g/l ALOGPS logp -0.78 ChemAxon pka_strongest_acidic -4.4 ChemAxon pka_strongest_basic 15 ChemAxon iupac N-(3-aminophenyl)carbamimidic acid ChemAxon average_mass 151.169 ChemAxon mono_mass 151.074561922 ChemAxon smiles NC1=CC(NC(O)=N)=CC=C1 ChemAxon formula C7H9N3O ChemAxon inchi InChI=1S/C7H9N3O/c8-5-2-1-3-6(4-5)10-7(9)11/h1-4H,8H2,(H3,9,10,11) ChemAxon inchikey ZNXSFVXZQBETRJ-UHFFFAOYSA-N ChemAxon polar_surface_area 82.13 ChemAxon refractivity 55.23 ChemAxon polarizability 15.25 ChemAxon rotatable_bond_count 1 ChemAxon acceptor_count 4 ChemAxon donor_count 4 ChemAxon physiological_charge 0 ChemAxon formal_charge 0 ChemAxon #<HealthEffect::ActiveRecord_Associations_CollectionProxy:0x00007f3baf168d60> 108806 97844