1.0 2026-03-26 22:37:44 UTC 2026-08-25 13:29:27 UTC Cyclohexylethylcarbamoyl chloride SmallMolecule Cyclohexylethylcarbamoyl chloride is an organic compound with the formula C9H16Cl1N1O1 and an average molecular weight of 189.68 g/mol. Cyclohexylethylcarbamoyl chloride belongs to the amino acids, peptides, and analogues, a subclass of carboxylic acids and derivatives within the organic compounds. This substance has been found in or released from one recorded source: drinking water and water supply, specifically drinking water. The recorded exposure route for this compound is oral. 263-753-6 Carbamic chloride, cyclohexyl(ethyl)- Cyclohexyl(ethyl)carbamic chloride cyclohexylethylcarbamoyl chloride N-Cyclohexyl N-ethylcarbamoyl chloride N-cyclohexyl-N-ethyl-carbamoyl chloride N-cyclohexyl-N-ethylcarbamoyl chloride C9H16Cl1N1O1 189.68 189.092042 62899-75-6 InChI=1S/C9H16ClNO/c1-2-11(9(10)12)8-6-4-3-5-7-8/h8H,2-7H2,1H3 ONKIPJDBUYZQMP-UHFFFAOYSA-N Organic compounds Organic acids and derivatives Carboxylic acids and derivatives Amino acids, peptides, and analogues Carbamic acid halides Carbonyl compounds Hydrocarbon derivatives Organic oxides Organochlorides Organonitrogen compounds Aliphatic homomonocyclic compound Carbamic acid halide Carbonyl group Hydrocarbon derivative Organic nitrogen compound Organic oxide Organic oxygen compound Organochloride Organohalogen compound Organonitrogen compound Organooxygen compound Aliphatic homomonocyclic compounds Detected and Not Quantified logp 3.9 average_mass 189.68 ChemAxon mono_mass 189.092042 ChemAxon formula C9H16Cl1N1O1 ChemAxon inchi InChI=1S/C9H16ClNO/c1-2-11(9(10)12)8-6-4-3-5-7-8/h8H,2-7H2,1H3 ChemAxon inchikey ONKIPJDBUYZQMP-UHFFFAOYSA-N ChemAxon #<HealthEffect::ActiveRecord_Associations_CollectionProxy:0x00007f72203a9cf8> 11332952 9507898