1.0 2026-04-03 15:26:10 UTC 2026-08-22 20:07:11 UTC (2-Methoxyethoxy)acetic acid SmallMolecule (2-Methoxyethoxy)acetic acid is an organic compound with the formula C5H10O4 and an average molecular weight of 134.13 g/mol. (2-Methoxyethoxy)acetic acid belongs to the carboxylic acids, a subclass of carboxylic acids and derivatives within the organic compounds. This substance is found in or released from two recorded sources: household cleaning and consumer products, specifically cigar cigarettes, and electrical and electronic equipment, specifically fixed capacitors and their manufacture. (2-METHOXYETHOXY)-ACETIC ACID (2-Methoxyethoxy)acetic acid 1753567 1H-imidazole, 2-ethyl-5-methyl- 2- aceticacid 2-(2-methoxy-ethoxy)acetic acid 2-(2-Methoxyethoxy) acetic acid 2-(2-Methoxyethoxy)-acetic acid 2-(2-Methoxyethoxy)Acetic Acid 2-(2-methoxyethoxy)aceticacid 2-Methoxyethoxyacetic acid 2758942 3,6-Dioxaheptanoic acid acetic acid, (2-methoxyethoxy) acetic acid, (2-methoxyethoxy)- Acetic acid, 2-(2-methoxyethoxy)- ACMC-1BRDX alpha-Methoxy-omega-caraboxy-polyethylen glycole CLLLODNOQBVIMS-UHFFFAOYSA-N mPEG-AA O-(2-Methoxyethyl)glycolic acid Poly(ethylene glycol) methyl ether carboxylic acid (Mn 1000) Poly(ethylene glycol) methyl ether carboxylic acid (Mn 2000) Poly(ethylene glycol) methyl ether carboxylic acid (Mn 5000) SBB008497 [16024-56-9] C5H10O4 134.131 134.057909 16024-56-9 COCCOCC(O)=O InChI=1S/C5H10O4/c1-8-2-3-9-4-5(6)7/h2-4H2,1H3,(H,6,7) CLLLODNOQBVIMS-UHFFFAOYSA-N Organic compounds Organic acids and derivatives Carboxylic acids and derivatives Carboxylic acids Carboxylic acids Carbonyl compounds Dialkyl ethers Hydrocarbon derivatives Monocarboxylic acids and derivatives Organic oxides Aliphatic acyclic compound Carbonyl group Carboxylic acid Dialkyl ether Ether Hydrocarbon derivative Monocarboxylic acid or derivatives Organic oxide Organic oxygen compound Organooxygen compound Aliphatic acyclic compounds Detected and Not Quantified logp -0.5 average_mass 134.131 ChemAxon mono_mass 134.057909 ChemAxon smiles COCCOCC(O)=O ChemAxon formula C5H10O4 ChemAxon inchi InChI=1S/C5H10O4/c1-8-2-3-9-4-5(6)7/h2-4H2,1H3,(H,6,7) ChemAxon inchikey CLLLODNOQBVIMS-UHFFFAOYSA-N ChemAxon #<HealthEffect::ActiveRecord_Associations_CollectionProxy:0x00007f722626a828> 27642 25718