1.0 2026-04-05 10:54:05 UTC 2026-08-25 22:31:00 UTC N-(5-Bromo-pyridin-2-yl)-succinamic acid SmallMolecule N-(5-Bromo-pyridin-2-yl)-succinamic acid belongs to the n-arylamides, a subclass of organonitrogen compounds within the organic compounds. This compound has the chemical formula C9H9BrN2O3 and an average molecular weight of 273.09 g/mol. Within the organic nitrogen compounds superclass, it is identified as having one recorded protein target, which is the genome polyprotein. C9H9BrN2O3 273.086 271.9796542 OC(=O)CCC(=O)NC1=NC=C(Br)C=C1 InChI=1S/C9H9BrN2O3/c10-6-1-2-7(11-5-6)12-8(13)3-4-9(14)15/h1-2,5H,3-4H2,(H,14,15)(H,11,12,13) XFYYQDHEDOXWGA-UHFFFAOYSA-N Organic compounds Organic nitrogen compounds Organonitrogen compounds N-arylamides N-arylamides Aryl bromides Azacyclic compounds Carbonyl compounds Carboxylic acids Fatty amides Heteroaromatic compounds Hydrocarbon derivatives Imidolactams Monocarboxylic acids and derivatives Organic oxides Organobromides Organopnictogen compounds Pyridines and derivatives Secondary carboxylic acid amides Aromatic heteromonocyclic compound Aryl bromide Aryl halide Azacycle Carbonyl group Carboxamide group Carboxylic acid Carboxylic acid derivative Fatty acyl Fatty amide Heteroaromatic compound Hydrocarbon derivative Imidolactam Monocarboxylic acid or derivatives N-arylamide Organic oxide Organic oxygen compound Organobromide Organohalogen compound Organoheterocyclic compound Organooxygen compound Organopnictogen compound Pyridine Secondary carboxylic acid amide Aromatic heteromonocyclic compounds Detected and Not Quantified logp 0.5 average_mass 273.086 ChemAxon mono_mass 271.9796542 ChemAxon smiles OC(=O)CCC(=O)NC1=NC=C(Br)C=C1 ChemAxon formula C9H9BrN2O3 ChemAxon inchi InChI=1S/C9H9BrN2O3/c10-6-1-2-7(11-5-6)12-8(13)3-4-9(14)15/h1-2,5H,3-4H2,(H,14,15)(H,11,12,13) ChemAxon inchikey XFYYQDHEDOXWGA-UHFFFAOYSA-N ChemAxon #<HealthEffect::ActiveRecord_Associations_CollectionProxy:0x00007f722487a148> DB08578 4284847 BE0001478