1.0 2026-08-26 00:25:54 UTC 2026-08-26 00:25:54 UTC N-hydroxynitramide SmallMolecule N-hydroxynitramide belongs to the other non-metal oxides, a subclass of other non-metal organides within the inorganic compounds. This compound has the chemical formula H2N2O3 and an average molecular weight of 78.03 g/mol. It is further classified as a homogeneous non-metal compound. H2N2O3 78.028 78.00654193 18550-55-5 InChI=1S/H2N2O3/c3-1-2(4)5/h1,3H BUIMWOLDCCGZKZ-UHFFFAOYSA-N Detected and Not Quantified logp 0 average_mass 78.028 ChemAxon mono_mass 78.00654193 ChemAxon formula H2N2O3 ChemAxon inchi InChI=1S/H2N2O3/c3-1-2(4)5/h1,3H ChemAxon inchikey BUIMWOLDCCGZKZ-UHFFFAOYSA-N ChemAxon #<HealthEffect::ActiveRecord_Associations_CollectionProxy:0x00007f727f8ae578> 5491930