1.0 2026-09-01 06:29:17 UTC 2026-09-01 06:29:17 UTC 2-(2-sulfanylethylamino)acetic acid SmallMolecule 2-(2-sulfanylethylamino)acetic acid is a chemical compound with the formula C4H9NO2S and an average molecular weight of 135.19 g/mol. It has been identified in or released from four recorded sources. These include household cleaning and consumer products, specifically tobacco smoke filters, pipe accessories, and cigar cigarettes. Additionally, the compound is associated with electrical and electronic equipment, specifically electrically stimulated smoking devices. C4H9NO2S 135.0353997 3724-83-2 C(CS)NCC(=O)O InChI=1S/C4H9NO2S/c6-4(7)3-5-1-2-8/h5,8H,1-3H2,(H,6,7) IAICFWDJMWEXAO-UHFFFAOYSA-N Detected and Not Quantified logp -2.6 mono_mass 135.0353997 ChemAxon smiles C(CS)NCC(=O)O ChemAxon formula C4H9NO2S ChemAxon inchi InChI=1S/C4H9NO2S/c6-4(7)3-5-1-2-8/h5,8H,1-3H2,(H,6,7) ChemAxon inchikey IAICFWDJMWEXAO-UHFFFAOYSA-N ChemAxon #<HealthEffect::ActiveRecord_Associations_CollectionProxy:0x00007f7226477940> 23372