| Identification |
|---|
| Common Name | Formothion |
|---|
| Class | Small Molecule |
|---|
| Description | |
|---|
| Contaminant Sources | - Clean Air Act Chemicals
- My Exposome Chemicals
- STOFF IDENT Compounds
|
|---|
| Contaminant Type | |
|---|
| Chemical Structure | |
|---|
| Synonyms | | Value | Source |
|---|
| Anthio | MeSH | | Antio | MeSH | | Formothion | MeSH |
|
|---|
| Chemical Formula | C6H12NO4PS2 |
|---|
| Average Molecular Mass | 257.260 g/mol |
|---|
| Monoisotopic Mass | 256.995 g/mol |
|---|
| CAS Registry Number | 2540-82-1 |
|---|
| IUPAC Name | O,O-dimethyl {[2-(N-methylformamido)-2-oxoethyl]sulfanyl}phosphonothioate |
|---|
| Traditional Name | O,O-dimethyl [2-(N-methylformamido)-2-oxoethyl]sulfanylphosphonothioate |
|---|
| SMILES | COP(=S)(OC)SCC(=O)N(C)C=O |
|---|
| InChI Identifier | InChI=1S/C6H12NO4PS2/c1-7(5-8)6(9)4-14-12(13,10-2)11-3/h5H,4H2,1-3H3 |
|---|
| InChI Key | AIKKULXCBHRFOS-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Description | Belongs to the class of organic compounds known as n-substituted carboxylic acid imides. N-substituted carboxylic acid imides are compounds comprising an N-substituted carboxylic acid imide group, with the general structure R1N(C(R2)=O)C(R3)=O (R2,R3=H, alkyl, aryl; R1=Anything but H). |
|---|
| Kingdom | Organic compounds |
|---|
| Super Class | Organic acids and derivatives |
|---|
| Class | Carboxylic acids and derivatives |
|---|
| Sub Class | Carboxylic acid derivatives |
|---|
| Direct Parent | N-substituted carboxylic acid imides |
|---|
| Alternative Parents | |
|---|
| Substituents | - Carboxylic acid imide, n-substituted
- Dithiophosphate s-ester
- Dithiophosphate o-ester
- Dicarboximide
- Organic dithiophosphate
- Organothiophosphorus compound
- Sulfenyl compound
- Organopnictogen compound
- Carbonyl group
- Organosulfur compound
- Organooxygen compound
- Organonitrogen compound
- Organic oxygen compound
- Organic nitrogen compound
- Organic oxide
- Hydrocarbon derivative
- Aliphatic acyclic compound
|
|---|
| Molecular Framework | Aliphatic acyclic compounds |
|---|
| External Descriptors | |
|---|
