| Identification |
|---|
| Common Name | QUININE BISULFATE |
|---|
| Class | Small Molecule |
|---|
| Description | Not Available |
|---|
| Contaminant Sources | - EAFUS Chemicals
- FooDB Chemicals
|
|---|
| Contaminant Type | Not Available |
|---|
| Chemical Structure | |
|---|
| Synonyms | | Value | Source |
|---|
| (R)-[(2S,4S,5R)-5-Ethenyl-1-azabicyclo[2.2.2]octan-2-yl](6-methoxyquinolin-4-yl)methanol; sulfate | Generator | | (R)-[(2S,4S,5R)-5-Ethenyl-1-azabicyclo[2.2.2]octan-2-yl](6-methoxyquinolin-4-yl)methanol; sulphate | Generator | | (R)-[(2S,4S,5R)-5-Ethenyl-1-azabicyclo[2.2.2]octan-2-yl](6-methoxyquinolin-4-yl)methanol; sulphuric acid | Generator | | Alphapharm brand OF quinine sulfate | MeSH | | Hoechst brand OF quinine sulfate | MeSH | | Lafran brand OF quinine hydrochloride | MeSH | | Legatrim | MeSH | | Odan brand OF quinine sulfate | MeSH | | Quinamm | MeSH | | Quinine lafran | MeSH | | Surquina | MeSH | | Quinimax | MeSH | | Quinine hydrochloride | MeSH | | Quinine sulphate | MeSH | | Foy brand OF quinine sulfate | MeSH | | Innotech brand OF quinine hydrochloride | MeSH | | Plough brand OF quinine sulfate | MeSH | | Quinine bisulfate | MeSH | | Quinine sulfate | MeSH | | Quinsul | MeSH | | Quinine | MeSH | | Aventis brand OF quinine bisulfate | MeSH | | Fawns and mcallan brand OF quinine bisulfate | MeSH | | Quinoctal | MeSH | | Quinson | MeSH | | Sulphate, quinine | MeSH | | Bisulfate, quinine | MeSH | | Hydrochloride, quinine | MeSH | | Prosana brand OF quinine bisulfate | MeSH | | Quinbisan | MeSH | | Quinbisul | MeSH | | Sulfate, quinine | MeSH | | Biquinate | MeSH | | Fawns and mcallan brand OF quinine sulfate | MeSH | | Myoquin | MeSH | | Quindan | MeSH | | Quinine-odan | MeSH | | Strema | MeSH | | (R)-[(2S,4S,5R)-5-Ethenyl-1-azabicyclo[2.2.2]octan-2-yl](6-methoxyquinolin-4-yl)methanol | | | sulfate | | | sulphate | | | sulphuric acid | |
|
|---|
| Chemical Formula | C20H26N2O6S |
|---|
| Average Molecular Mass | 422.500 g/mol |
|---|
| Monoisotopic Mass | 422.151 g/mol |
|---|
| CAS Registry Number | 549-56-4 |
|---|
| IUPAC Name | (R)-[(2S,4S,5R)-5-ethenyl-1-azabicyclo[2.2.2]octan-2-yl](6-methoxyquinolin-4-yl)methanol; sulfuric acid |
|---|
| Traditional Name | quinine; sulfuric acid |
|---|
| SMILES | OS(O)(=O)=O.[H][C@@](O)(C1=C2C=C(OC)C=CC2=NC=C1)[C@]1([H])C[C@]2([H])CCN1C[C@]2([H])C=C |
|---|
| InChI Identifier | InChI=1S/C20H24N2O2.H2O4S/c1-3-13-12-22-9-7-14(13)10-19(22)20(23)16-6-8-21-18-5-4-15(24-2)11-17(16)18;1-5(2,3)4/h3-6,8,11,13-14,19-20,23H,1,7,9-10,12H2,2H3;(H2,1,2,3,4)/t13-,14-,19-,20+;/m0./s1 |
|---|
| InChI Key | AKYHKWQPZHDOBW-DSXUQNDKSA-N |
|---|
